![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size | Description |
|---|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | ||
![[DIR]](/icons/folder.gif){kind=icon} | cython/ | 2014-06-08 09:15 | - | |
| cyrus-sasl2/ | 2014-06-08 09:15 | - | |
| cyrus-imspd/ | 2014-06-08 09:15 | - | |
| cyrus-imapd-2.4/ | 2014-06-08 09:15 | - | |
| cynthiune.app/ | 2014-06-08 09:15 | - | |
| cycle/ | 2014-06-08 09:15 | - | |
| cyclades-serial-client/ | 2014-06-08 09:15 | - | |
| cycfx2prog/ | 2014-06-08 09:15 | - | |
| cxxtools/ | 2014-06-08 09:15 | - | |
| cxxtest/ | 2014-06-08 09:15 | - | |
| cxref/ | 2014-06-08 09:15 | - | |
| cwirc/ | 2014-06-08 09:15 | - | |
| cwiid/ | 2014-06-08 09:15 | - | |
| cwidget/ | 2014-06-08 09:15 | - | |
| cwebx/ | 2014-06-08 09:15 | - | |
| cweb-latex/ | 2014-06-08 09:15 | - | |
| cwdaemon/ | 2014-06-08 09:15 | - | |
| cvxopt/ | 2014-06-08 09:15 | - | |
| cvsweb/ | 2014-06-08 09:15 | - | |
| cvsutils/ | 2014-06-08 09:15 | - | |
| cvstrac/ | 2014-06-08 09:15 | - | |
| cvssuck/ | 2014-06-08 09:15 | - | |
| cvsps/ | 2014-06-08 09:15 | - | |
| cvsgraph/ | 2014-06-08 09:15 | - | |
| cvsdelta/ | 2014-06-08 09:15 | - | |
| cvsd/ | 2014-06-08 09:15 | - | |
| cvsconnect/ | 2014-06-08 09:15 | - | |
| cvschangelogbuilder/ | 2014-06-08 09:15 | - | |
| cvs2svn/ | 2014-06-08 09:15 | - | |
| cvs2html/ | 2014-06-08 09:15 | - | |
| cvs2cl/ | 2014-06-08 09:15 | - | |
| cvs/ | 2014-06-08 09:15 | - | |
| cvs-syncmail/ | 2014-06-08 09:15 | - | |
| cvs-mailcommit/ | 2014-06-08 09:15 | - | |
| cvs-buildpackage/ | 2014-06-08 09:15 | - | |
| cvs-autoreleasedeb/ | 2014-06-08 09:15 | - | |
| cvm/ | 2014-06-08 09:15 | - | |
| cvector/ | 2014-06-08 09:15 | - | |
| cvc3/ | 2014-06-08 09:15 | - | |
| cuyo/ | 2014-06-08 09:15 | - | |
| cutycapt/ | 2014-06-08 09:15 | - | |
| cutter/ | 2014-06-08 09:15 | - | |
| cutter-testing-framework/ | 2014-06-08 09:15 | - | |
| cutils/ | 2014-06-08 09:15 | - | |
| cutesdr/ | 2014-06-08 09:15 | - | |
| cutecom/ | 2014-06-08 09:15 | - | |
| customdeb/ | 2014-06-08 09:15 | - | |
| custom-tab-width/ | 2014-06-08 09:15 | - | |
| curves/ | 2014-06-08 09:15 | - | |
| curtain/ | 2014-06-08 09:15 | - | |
| curlftpfs/ | 2014-06-08 09:15 | - | |
| curl/ | 2014-06-08 09:15 | - | |
| cupt/ | 2014-06-08 09:15 | - | |
| cups/ | 2014-06-08 09:15 | - | |
| cups-pk-helper/ | 2014-06-08 09:15 | - | |
| cups-pdf/ | 2014-06-08 09:15 | - | |
| cups-filters/ | 2014-06-08 09:15 | - | |
| cup/ | 2014-06-08 09:15 | - | |
| cunit/ | 2014-06-08 09:15 | - | |
| cultivation/ | 2014-06-08 09:15 | - | |
| culmus/ | 2014-06-08 09:15 | - | |
| culmus-fancy/ | 2014-06-08 09:15 | - | |
| cuetools/ | 2014-06-08 09:15 | - | |
| cue2toc/ | 2014-06-08 09:15 | - | |
| cudf/ | 2014-06-08 09:15 | - | |
| cucumber/ | 2014-06-08 09:15 | - | |
| cubictemp/ | 2014-06-08 09:15 | - | |
| cube2font/ | 2014-06-08 09:15 | - | |
| cuba/ | 2014-06-08 09:15 | - | |
| ctwm/ | 2014-06-08 09:15 | - | |
| ctsim/ | 2014-06-08 09:15 | - | |
| ctpl/ | 2014-06-08 09:15 | - | |
| ctorrent/ | 2014-06-08 09:15 | - | |
| ctn/ | 2014-06-08 09:15 | - | |
| ctn-doc/ | 2014-06-08 09:15 | - | |
| ctioga2/ | 2014-06-08 09:15 | - | |
| cthumb/ | 2014-06-08 09:15 | - | |
| ctemplate/ | 2014-06-08 09:15 | - | |
| ctdb/ | 2014-06-08 09:15 | - | |
| ctapi/ | 2014-06-08 09:15 | - | |
| csync2/ | 2014-06-08 09:15 | - | |
| csv2latex/ | 2014-06-08 09:15 | - | |
| cstream/ | 2014-06-08 09:15 | - | |
| cstocs/ | 2014-06-08 09:15 | - | |
| cssutils/ | 2014-06-08 09:15 | - | |
| csstidy/ | 2014-06-08 09:15 | - | |
| cssparser/ | 2014-06-08 09:15 | - | |
| cssed/ | 2014-06-08 09:15 | - | |
| cssc/ | 2014-06-08 09:15 | - | |
| css-mode/ | 2014-06-08 09:15 | - | |
| csound/ | 2014-06-08 09:15 | - | |
| csound-manual/ | 2014-06-08 09:15 | - | |
| csmash/ | 2014-06-08 09:15 | - | |
| csmash-demosong/ | 2014-06-08 09:15 | - | |
| csh/ | 2014-06-08 09:15 | - | |
| cscope/ | 2014-06-08 09:15 | - | |
| crystalhd/ | 2014-06-08 09:24 | - | |
| crystalcursors/ | 2014-06-08 09:15 | - | |
| cryptsetup/ | 2014-06-08 09:15 | - | |
| cryptokit/ | 2014-06-08 09:15 | - | |
| cryptmount/ | 2014-06-08 09:15 | - | |
| cryptkeeper/ | 2014-06-08 09:15 | - | |
| cryptgps/ | 2014-06-08 09:15 | - | |
| cryptcat/ | 2014-06-08 09:15 | - | |
| crypt++el/ | 2014-06-08 09:15 | - | |
| cruft/ | 2014-06-08 09:15 | - | |
| crtmpserver/ | 2014-06-08 09:15 | - | |
| crossroads/ | 2014-06-08 09:15 | - | |
| crosshurd/ | 2014-06-08 09:15 | - | |
| crossfire/ | 2014-06-08 09:15 | - | |
| crossfire-maps/ | 2014-06-08 09:15 | - | |
| crossfire-maps-small/ | 2014-06-08 09:15 | - | |
| crossfire-client/ | 2014-06-08 09:15 | - | |
| crossfire-client-sounds/ | 2014-06-08 09:15 | - | |
| crossfire-client-images/ | 2014-06-08 09:15 | - | |
| cronutils/ | 2014-06-08 09:15 | - | |
| cronometer/ | 2014-06-08 09:15 | - | |
| cronolog/ | 2014-06-08 09:15 | - | |
| cron/ | 2014-06-08 09:15 | - | |
| cron-deja-vu/ | 2014-06-08 09:15 | - | |
| cron-apt/ | 2014-06-08 09:15 | - | |
| crm114/ | 2014-06-08 09:15 | - | |
| critterding/ | 2014-06-08 09:15 | - | |
| criticalmass/ | 2014-06-08 09:15 | - | |
| crip/ | 2014-06-08 09:15 | - | |
| crimson/ | 2014-06-08 09:15 | - | |
| cricket/ | 2014-06-08 09:15 | - | |
| creoleparser/ | 2014-06-08 09:15 | - | |
| creepy/ | 2014-06-08 09:15 | - | |
| createrepo/ | 2014-06-08 09:15 | - | |
| create-resources/ | 2014-06-08 09:15 | - | |
| cream/ | 2014-06-08 09:15 | - | |
| crda/ | 2014-06-08 09:15 | - | |
| crawl/ | 2014-06-08 09:15 | - | |
| crasm/ | 2014-06-08 09:15 | - | |
| crashme/ | 2014-06-08 09:15 | - | |
| crashmail/ | 2014-06-08 09:15 | - | |
| crash/ | 2014-06-08 09:15 | - | |
| cramfsswap/ | 2014-06-08 09:15 | - | |
| cramfs/ | 2014-06-08 09:15 | - | |
| cracklib2/ | 2014-06-08 09:15 | - | |
| crack/ | 2014-06-08 09:15 | - | |
| crack-attack/ | 2014-06-08 09:15 | - | |
| cqrlog/ | 2014-06-08 09:15 | - | |
| cqrlib/ | 2014-06-08 09:15 | - | |
| cpushare/ | 2014-06-08 09:15 | - | |
| cpuset/ | 2014-06-08 09:15 | - | |
| cpulimit/ | 2014-06-08 09:15 | - | |
| cpuid/ | 2014-06-08 09:15 | - | |
| cpufrequtils/ | 2014-06-08 09:15 | - | |
| cpufreqd/ | 2014-06-08 09:15 | - | |
| cpuburn/ | 2014-06-08 09:15 | - | |
| cpu/ | 2014-06-08 09:15 | - | |
| cproto/ | 2014-06-08 09:15 | - | |
| cpqarrayd/ | 2014-06-08 09:15 | - | |
| cpputest/ | 2014-06-08 09:15 | - | |
| cppunit/ | 2014-06-08 09:15 | - | |
| cpptasks/ | 2014-06-08 09:15 | - | |
| cppo/ | 2014-06-08 09:15 | - | |
| cpphs/ | 2014-06-08 09:15 | - | |
| cppcheck/ | 2014-06-08 09:15 | - | |
| cpmtools/ | 2014-06-08 09:15 | - | |
| cpm/ | 2014-06-08 09:15 | - | |
| cplay/ | 2014-06-08 09:15 | - | |
| cpl/ | 2014-06-08 09:15 | - | |
| cpipe/ | 2014-06-08 09:15 | - | |
| cpio/ | 2014-06-08 09:15 | - | |
| cpanminus/ | 2014-06-08 09:15 | - | |
| cpan-listchanges/ | 2014-06-08 09:15 | - | |
| cp2k/ | 2014-06-08 09:15 | - | |
| cowsay/ | 2014-06-08 09:15 | - | |
| cowdancer/ | 2014-06-08 09:15 | - | |
| cowbell/ | 2014-06-08 09:15 | - | |
| covered/ | 2014-06-08 09:15 | - | |
| courierpassd/ | 2014-06-08 09:15 | - | |
| couriergrey/ | 2014-06-08 09:15 | - | |
| couriergraph/ | 2014-06-08 09:15 | - | |
| courier/ | 2014-06-08 09:15 | - | |
| courier-filter-perl/ | 2014-06-08 09:15 | - | |
| courier-authlib/ | 2014-06-08 09:15 | - | |
| couchdb/ | 2014-06-08 09:15 | - | |
| cothreads/ | 2014-06-08 09:15 | - | |
| cortina/ | 2014-06-08 09:15 | - | |
| cortado/ | 2014-06-08 09:15 | - | |
| corosync/ | 2014-06-08 09:15 | - | |
| corkscrew/ | 2014-06-08 09:15 | - | |
| coriander/ | 2014-06-08 09:15 | - | |
| coreutils/ | 2014-06-08 09:15 | - | |
| coq/ | 2014-06-08 09:15 | - | |
| coq-float/ | 2014-06-08 09:15 | - | |
| copyright-update/ | 2014-06-08 09:15 | - | |
| copyfs/ | 2014-06-08 09:15 | - | |
| coolmail/ | 2014-06-08 09:15 | - | |
| coolkey/ | 2014-06-08 09:15 | - | |
| cookietool/ | 2014-06-08 09:15 | - | |
| cookie-monster/ | 2014-06-08 09:15 | - | |
| cook/ | 2014-06-08 09:15 | - | |
| convmv/ | 2014-06-08 09:15 | - | |
| convlit/ | 2014-06-08 09:15 | - | |
| convertall/ | 2014-06-08 09:15 | - | |
| controlaula/ | 2014-06-08 09:15 | - | |
| contextfree/ | 2014-06-08 09:15 | - | |
| context/ | 2014-06-08 09:15 | - | |
| context-modules/ | 2014-06-08 09:15 | - | |
| contacts/ | 2014-06-08 09:15 | - | |
| conspy/ | 2014-06-08 09:15 | - | |
| consolekit/ | 2014-06-08 09:15 | - | |
| console-tools/ | 2014-06-08 09:15 | - | |
| console-setup/ | 2014-06-08 09:15 | - | |
| console-log/ | 2014-06-08 09:15 | - | |
| console-data/ | 2014-06-08 09:15 | - | |
| console-cyrillic/ | 2014-06-08 09:15 | - | |
| console-common/ | 2014-06-08 09:15 | - | |
| console-braille/ | 2014-06-08 09:15 | - | |
| cons/ | 2014-06-08 09:15 | - | |
| conque/ | 2014-06-08 09:15 | - | |
| conntrack/ | 2014-06-08 09:15 | - | |
| connman/ | 2014-06-08 09:15 | - | |
| connectomeviewer/ | 2014-06-08 09:15 | - | |
| connectagram/ | 2014-06-08 09:15 | - | |
| connect-proxy/ | 2014-06-08 09:15 | - | |
| conky/ | 2014-06-08 09:15 | - | |
| conkeror/ | 2014-06-08 09:15 | - | |
| congruity/ | 2014-06-08 09:15 | - | |
| confuse/ | 2014-06-08 09:15 | - | |
| confluence/ | 2014-06-08 09:15 | - | |
| configure-debian/ | 2014-06-08 09:15 | - | |
| configshell/ | 2014-06-08 09:15 | - | |
| configobj/ | 2014-06-08 09:15 | - | |
| config-package-dev/ | 2014-06-08 09:15 | - | |
| config-manager/ | 2014-06-08 09:15 | - | |
| confget/ | 2014-06-08 09:15 | - | |
| confclerk/ | 2014-06-08 09:15 | - | |
| cone/ | 2014-06-08 09:15 | - | |
| conduit/ | 2014-06-08 09:15 | - | |
| condor/ | 2014-06-08 09:15 | - | |
| concurrent-dfsg/ | 2014-06-08 09:15 | - | |
| concordance/ | 2014-06-08 09:15 | - | |
| concalc/ | 2014-06-08 09:15 | - | |
| comprez/ | 2014-06-08 09:15 | - | |
| composite/ | 2014-06-08 09:15 | - | |
| compiz-fusion-bcop/ | 2014-06-08 09:15 | - | |
| compass-yui-plugin/ | 2014-06-08 09:15 | - | |
| compass-susy-plugin/ | 2014-06-08 09:15 | - | |
| compass-slickmap-plugin/ | 2014-06-08 09:15 | - | |
| compass-layoutgala-plugin/ | 2014-06-08 09:15 | - | |
| compass-h5bp-plugin/ | 2014-06-08 09:15 | - | |
| compass-fancy-buttons-plugin/ | 2014-06-08 09:15 | - | |
| compartment/ | 2014-06-08 09:15 | - | |
| comparepdf/ | 2014-06-08 09:15 | - | |
| compactheader/ | 2014-06-08 09:15 | - | |
| commons-vfs/ | 2014-06-08 09:15 | - | |
| commons-pool/ | 2014-06-08 09:15 | - | |
| commons-parent/ | 2014-06-08 09:15 | - | |
| commons-math/ | 2014-06-08 09:15 | - | |
| commons-jci/ | 2014-06-08 09:15 | - | |
| commons-javaflow/ | 2014-06-08 09:15 | - | |
| commons-io/ | 2014-06-08 09:15 | - | |
| commons-httpclient/ | 2014-06-08 09:15 | - | |
| commons-exec/ | 2014-06-08 09:15 | - | |
| commons-daemon/ | 2014-06-08 09:15 | - | |
| commons-csv/ | 2014-06-08 09:15 | - | |
| commons-configuration/ | 2014-06-08 09:15 | - | |
| commons-beanutils/ | 2014-06-08 09:15 | - | |
| common-lisp-controller/ | 2014-06-08 09:15 | - | |
| commit-patch/ | 2014-06-08 09:15 | - | |
| commando/ | 2014-06-08 09:15 | - | |
| command-runner-applet/ | 2014-06-08 09:15 | - | |
| command-not-found/ | 2014-06-08 09:15 | - | |
| comixcursors/ | 2014-06-08 09:15 | - | |
| comix/ | 2014-06-08 09:15 | - | |
| comgt/ | 2014-06-08 09:15 | - | |
| comedilib/ | 2014-06-08 09:15 | - | |
| combat/ | 2014-06-08 09:15 | - | |
| colrconv/ | 2014-06-08 09:15 | - | |
| colortest/ | 2014-06-08 09:15 | - | |
| colortest-python/ | 2014-06-08 09:15 | - | |
| colortail/ | 2014-06-08 09:15 | - | |
| colorpicker/ | 2014-06-08 09:15 | - | |
| colorname/ | 2014-06-08 09:15 | - | |
| colormake/ | 2014-06-08 09:15 | - | |
| colorhug-client/ | 2014-06-08 09:15 | - | |
| colorgcc/ | 2014-06-08 09:15 | - | |
| colordiff/ | 2014-06-08 09:15 | - | |
| colord/ | 2014-06-08 09:15 | - | |
| colorcode/ | 2014-06-08 09:15 | - | |
| colorchooser/ | 2014-06-08 09:15 | - | |
| colorblind/ | 2014-06-08 09:15 | - | |
| colo/ | 2014-06-08 09:15 | - | |
| colo-installer/ | 2014-06-08 09:15 | - | |
| collectl/ | 2014-06-08 09:15 | - | |
| collectl-utils/ | 2014-06-08 09:15 | - | |
| collections15/ | 2014-06-08 09:15 | - | |
| collectd/ | 2014-06-08 09:15 | - | |
| collatinus/ | 2014-06-08 09:15 | - | |
| collabtive/ | 2014-06-08 09:15 | - | |
| colibri/ | 2014-06-08 09:15 | - | |
| coldfire/ | 2014-06-08 09:15 | - | |
| coinutils/ | 2014-06-08 09:15 | - | |
| coinst/ | 2014-06-08 09:15 | - | |
| coinor-vol/ | 2014-06-08 09:15 | - | |
| coinor-symphony/ | 2014-06-08 09:15 | - | |
| coinor-osi/ | 2014-06-08 09:15 | - | |
| coinor-ipopt/ | 2014-06-08 09:15 | - | |
| coinor-flopc++/ | 2014-06-08 09:15 | - | |
| coinor-dylp/ | 2014-06-08 09:15 | - | |
| coinor-csdp/ | 2014-06-08 09:15 | - | |
| coinor-cgl/ | 2014-06-08 09:15 | - | |
| coinor-cbc/ | 2014-06-08 09:15 | - | |
| coin3/ | 2014-06-08 09:15 | - | |
| coils/ | 2014-06-08 09:15 | - | |
| coherence/ | 2014-06-08 09:15 | - | |
| cogl/ | 2014-06-08 09:15 | - | |
| codfis/ | 2014-06-08 09:15 | - | |
| codeville/ | 2014-06-08 09:15 | - | |
| codetools/ | 2014-06-08 09:15 | - | |
| codespeak-lib/ | 2014-06-08 09:15 | - | |
| coderay/ | 2014-06-08 09:15 | - | |
| codenarc/ | 2014-06-08 09:15 | - | |
| codemirror-js/ | 2014-06-08 09:15 | - | |
| codegroup/ | 2014-06-08 09:15 | - | |
| codecgraph/ | 2014-06-08 09:15 | - | |
| codeblocks/ | 2014-06-08 09:15 | - | |
| code2html/ | 2014-06-08 09:15 | - | |
| code-saturne/ | 2014-06-08 09:15 | - | |
| coco-java/ | 2014-06-08 09:15 | - | |
| coco-doc/ | 2014-06-08 09:15 | - | |
| coco-cs/ | 2014-06-08 09:15 | - | |
| coco-cpp/ | 2014-06-08 09:15 | - | |
| coccinelle/ | 2014-06-08 09:15 | - | |
| coccinella/ | 2014-06-08 09:15 | - | |
| cobertura/ | 2014-06-08 09:15 | - | |
| cobertura-maven-plugin/ | 2014-06-08 09:15 | - | |
| cobalt-panel-utils/ | 2014-06-08 09:15 | - | |
| coala/ | 2014-06-08 09:15 | - | |
| cntlm/ | 2014-06-08 09:15 | - | |
| cnf/ | 2014-06-08 09:15 | - | |
| cmus/ | 2014-06-08 09:15 | - | |
| cmucl/ | 2014-06-08 09:15 | - | |
| cmtk/ | 2014-06-08 09:15 | - | |
| cmt/ | 2014-06-08 09:15 | - | |
| cmph/ | 2014-06-08 09:15 | - | |
| cmospwd/ | 2014-06-08 09:15 | - | |
| cmor/ | 2014-06-08 09:15 | - | |
| cmip5-cmor-tables/ | 2014-06-08 09:15 | - | |
| cminpack/ | 2014-06-08 09:15 | - | |
| cmigrep/ | 2014-06-08 09:15 | - | |
| cmigemo/ | 2014-06-08 09:15 | - | |
| cmdtest/ | 2014-06-08 09:15 | - | |
| cmdpack/ | 2014-06-08 09:15 | - | |
| cmd2/ | 2014-06-08 09:15 | - | |
| cmatrix/ | 2014-06-08 09:15 | - | |
| cmake/ | 2014-06-08 09:15 | - | |
| cm-super/ | 2014-06-08 09:15 | - | |
| clzip/ | 2014-06-08 09:15 | - | |
| clxclient/ | 2014-06-08 09:15 | - | |
| clutter-sharp/ | 2014-06-08 09:15 | - | |
| clutter-imcontext/ | 2014-06-08 09:15 | - | |
| clutter-gtk/ | 2014-06-08 09:15 | - | |
| clutter-gst/ | 2014-06-08 09:15 | - | |
| clutter-gesture/ | 2014-06-08 09:15 | - | |
| clutter-1.0/ | 2014-06-08 09:15 | - | |
| clusterssh/ | 2014-06-08 09:15 | - | |
| clustershell/ | 2014-06-08 09:15 | - | |
| cluster/ | 2014-06-08 09:15 | - | |
| cluster-glue/ | 2014-06-08 09:15 | - | |
| cluster-agents/ | 2014-06-08 09:15 | - | |
| clustalx/ | 2014-06-08 09:15 | - | |
| clustalw/ | 2014-06-08 09:15 | - | |
| clustalo/ | 2014-06-08 09:15 | - | |
| clucy/ | 2014-06-08 09:15 | - | |
| clucene-core/ | 2014-06-08 09:15 | - | |
| clthreads/ | 2014-06-08 09:15 | - | |
| clp/ | 2014-06-08 09:15 | - | |
| cloop/ | 2014-06-08 09:15 | - | |
| cloog/ | 2014-06-08 09:15 | - | |
| cloog-ppl/ | 2014-06-08 09:15 | - | |
| clonalframe/ | 2014-06-08 09:15 | - | |
| clojure1.4/ | 2014-06-08 09:15 | - | |
| clojure1.2/ | 2014-06-08 09:15 | - | |
| clojure-maven-plugin/ | 2014-06-08 09:15 | - | |
| clojure-contrib/ | 2014-06-08 09:15 | - | |
| clock-setup/ | 2014-06-08 09:15 | - | |
| cloc/ | 2014-06-08 09:15 | - | |
| cln/ | 2014-06-08 09:15 | - | |
| clive/ | 2014-06-08 09:15 | - | |
| clisp/ | 2014-06-08 09:15 | - | |
| clirr/ | 2014-06-08 09:15 | - | |
| clirr-maven-plugin/ | 2014-06-08 09:15 | - | |
| cliquer/ | 2014-06-08 09:15 | - | |
| clips/ | 2014-06-08 09:15 | - | |
| clips-doc/ | 2014-06-08 09:15 | - | |
| clippoly/ | 2014-06-08 09:15 | - | |
| clipit/ | 2014-06-08 09:15 | - | |
| clipf/ | 2014-06-08 09:15 | - | |
| cliofetion/ | 2014-06-08 09:15 | - | |
| clinica/ | 2014-06-08 09:15 | - | |
| clif/ | 2014-06-08 09:15 | - | |
| cli-common/ | 2014-06-08 09:15 | - | |
| clhep/ | 2014-06-08 09:15 | - | |
| clfswm/ | 2014-06-08 09:15 | - | |
| clex/ | 2014-06-08 09:15 | - | |
| clementine/ | 2014-06-08 09:15 | - | |
| clearsilver/ | 2014-06-08 09:15 | - | |
| clearlooks-phenix-theme/ | 2014-06-08 09:15 | - | |
| clean-crypto/ | 2014-06-08 09:15 | - | |
| cldump/ | 2014-06-08 09:15 | - | |
| clc-intercal/ | 2014-06-08 09:15 | - | |
| clawsker/ | 2014-06-08 09:15 | - | |
| claws-mail/ | 2014-06-08 09:15 | - | |
| claws-mail-themes/ | 2014-06-08 09:15 | - | |
| claws-mail-extra-plugins/ | 2014-06-08 09:15 | - | |
| classworlds/ | 2014-06-08 09:15 | - | |
| clasp/ | 2014-06-08 09:15 | - | |
| clanlib/ | 2014-06-08 09:15 | - | |
| clang/ | 2014-06-08 09:15 | - | |
| clamz/ | 2014-06-08 09:15 | - | |
| clamtk/ | 2014-06-08 09:15 | - | |
| clamsmtp/ | 2014-06-08 09:15 | - | |
| clamav/ | 2014-06-08 09:15 | - | |
| clamav-unofficial-sigs/ | 2014-06-08 09:15 | - | |
| clamassassin/ | 2014-06-08 09:15 | - | |
| clam/ | 2014-06-08 09:15 | - | |
| clam-networkeditor/ | 2014-06-08 09:15 | - | |
| clam-chordata/ | 2014-06-08 09:15 | - | |
| clalsadrv/ | 2014-06-08 09:15 | - | |
| cl-xptest/ | 2014-06-08 09:15 | - | |
| cl-xmls/ | 2014-06-08 09:15 | - | |
| cl-xlunit/ | 2014-06-08 09:15 | - | |
| cl-usocket/ | 2014-06-08 09:15 | - | |
| cl-uffi/ | 2014-06-08 09:15 | - | |
| cl-sql/ | 2014-06-08 09:15 | - | |
| cl-split-sequence/ | 2014-06-08 09:15 | - | |
| cl-spatial-trees/ | 2014-06-08 09:15 | - | |
| cl-salza/ | 2014-06-08 09:15 | - | |
| cl-rt/ | 2014-06-08 09:15 | - | |
| cl-rss/ | 2014-06-08 09:15 | - | |
| cl-rsm-mod/ | 2014-06-08 09:15 | - | |
| cl-rlc/ | 2014-06-08 09:15 | - | |
| cl-reversi/ | 2014-06-08 09:15 | - | |
| cl-regex/ | 2014-06-08 09:15 | - | |
| cl-puri/ | 2014-06-08 09:15 | - | |
| cl-pubmed/ | 2014-06-08 09:15 | - | |
| cl-ptester/ | 2014-06-08 09:15 | - | |
| cl-ppcre/ | 2014-06-08 09:15 | - | |
| cl-postoffice/ | 2014-06-08 09:15 | - | |
| cl-portable-aserve/ | 2014-06-08 09:15 | - | |
| cl-plplot/ | 2014-06-08 09:15 | - | |
| cl-pipes/ | 2014-06-08 09:15 | - | |
| cl-photo/ | 2014-06-08 09:15 | - | |
| cl-pg/ | 2014-06-08 09:15 | - | |
| cl-modlisp/ | 2014-06-08 09:15 | - | |
| cl-md5/ | 2014-06-08 09:15 | - | |
| cl-mcclim/ | 2014-06-08 09:15 | - | |
| cl-lw-compat/ | 2014-06-08 09:15 | - | |
| cl-lml2/ | 2014-06-08 09:15 | - | |
| cl-lml/ | 2014-06-08 09:15 | - | |
| cl-lexer/ | 2014-06-08 09:15 | - | |
| cl-launch/ | 2014-06-08 09:15 | - | |
| cl-kmrcl/ | 2014-06-08 09:15 | - | |
| cl-irc/ | 2014-06-08 09:15 | - | |
| cl-irc-logger/ | 2014-06-08 09:15 | - | |
| cl-hyperobject/ | 2014-06-08 09:15 | - | |
| cl-getopt/ | 2014-06-08 09:15 | - | |
| cl-ftp/ | 2014-06-08 09:15 | - | |
| cl-flexichain/ | 2014-06-08 09:15 | - | |
| cl-fftw3/ | 2014-06-08 09:15 | - | |
| cl-contextl/ | 2014-06-08 09:15 | - | |
| cl-clx-sbcl/ | 2014-06-08 09:15 | - | |
| cl-cluck/ | 2014-06-08 09:15 | - | |
| cl-closer-mop/ | 2014-06-08 09:15 | - | |
| cl-base64/ | 2014-06-08 09:15 | - | |
| cl-babel/ | 2014-06-08 09:15 | - | |
| cl-awk/ | 2014-06-08 09:15 | - | |
| cl-asdf/ | 2014-06-08 09:15 | - | |
| cl-alexandria/ | 2014-06-08 09:15 | - | |
| cksfv/ | 2014-06-08 09:15 | - | |
| ckport/ | 2014-06-08 09:15 | - | |
| ckermit/ | 2014-06-08 09:15 | - | |
| ckeditor/ | 2014-06-08 09:15 | - | |
| ckanclient/ | 2014-06-08 09:15 | - | |
| cjk/ | 2014-06-08 09:15 | - | |
| cjet/ | 2014-06-08 09:15 | - | |
| citadel/ | 2014-06-08 09:15 | - | |
| circuslinux/ | 2014-06-08 09:15 | - | |
| circuits/ | 2014-06-08 09:15 | - | |
| circos/ | 2014-06-08 09:15 | - | |
| circos-tools/ | 2014-06-08 09:15 | - | |
| cipux/ | 2014-06-08 09:15 | - | |
| cipux-task/ | 2014-06-08 09:15 | - | |
| cipux-storage/ | 2014-06-08 09:15 | - | |
| cipux-rpc/ | 2014-06-08 09:15 | - | |
| cipux-rpc-client/ | 2014-06-08 09:15 | - | |
| cipux-rbac-simple/ | 2014-06-08 09:15 | - | |
| cipux-passwd/ | 2014-06-08 09:15 | - | |
| cipux-object/ | 2014-06-08 09:15 | - | |
| cipux-dog/ | 2014-06-08 09:15 | - | |
| cipux-cat-web/ | 2014-06-08 09:15 | - | |
| ciphersaber/ | 2014-06-08 09:15 | - | |
| cinfony/ | 2014-06-08 09:15 | - | |
| cimg/ | 2014-06-08 09:15 | - | |
| cil/ | 2014-06-08 09:15 | - | |
| cifs-utils/ | 2014-06-08 09:15 | - | |
| ciderwebmail/ | 2014-06-08 09:15 | - | |
| cia-clients/ | 2014-06-08 09:15 | - | |
| chuck/ | 2014-06-08 09:15 | - | |
| chrpath/ | 2014-06-08 09:15 | - | |
| chrootuid/ | 2014-06-08 09:15 | - | |
| chrony/ | 2014-06-08 09:15 | - | |
| chronicle/ | 2014-06-08 09:15 | - | |
| chron/ | 2014-06-08 09:15 | - | |
| chromium-bsu/ | 2014-06-08 09:15 | - | |
| chromium-browser/ | 2014-06-08 09:15 | - | |
| chromaprint/ | 2014-06-08 09:15 | - | |
| chordii/ | 2014-06-08 09:15 | - | |
| choqok/ | 2014-06-08 09:15 | - | |
| choosewm/ | 2014-06-08 09:15 | - | |
| choose-mirror/ | 2014-06-08 09:15 | - | |
| chntpw/ | 2014-06-08 09:15 | - | |
| chmlib/ | 2014-06-08 09:15 | - | |
| chm2pdf/ | 2014-06-08 09:15 | - | |
| chktex/ | 2014-06-08 09:15 | - | |
| chkrootkit/ | 2014-06-08 09:15 | - | |
| chkconfig/ | 2014-06-08 09:15 | - | |
| chise-base/ | 2014-06-08 09:15 | - | |
| chirp/ | 2014-06-08 09:15 | - | |
| chipw/ | 2014-06-08 09:15 | - | |
| chipmunk/ | 2014-06-08 09:15 | - | |
| chimera2/ | 2014-06-08 09:15 | - | |
| childsplay/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-sv/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-sl/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-ru/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-ro/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-pt/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-nl/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-nb/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-it/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-fr/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-es/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-en-gb/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-el/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-de/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-ca/ | 2014-06-08 09:15 | - | |
| childsplay-alphabet-sounds-bg/ | 2014-06-08 09:15 | - | |
| chicken/ | 2014-06-08 09:15 | - | |
| chiark-utils/ | 2014-06-08 09:15 | - | |
| chiark-tcl/ | 2014-06-08 09:15 | - | |
| chewmail/ | 2014-06-08 09:15 | - | |
| cherrytree/ | 2014-06-08 09:15 | - | |
| cherrypy3/ | 2014-06-08 09:15 | - | |
| chemtool/ | 2014-06-08 09:15 | - | |
| chemical-structures/ | 2014-06-08 09:15 | - | |
| chemical-mime-data/ | 2014-06-08 09:15 | - | |
| chemfp/ | 2014-06-08 09:15 | - | |
| chemeq/ | 2014-06-08 09:15 | - | |
| chef/ | 2014-06-08 09:15 | - | |
| chef-solr/ | 2014-06-08 09:15 | - | |
| chef-server-api/ | 2014-06-08 09:15 | - | |
| chef-expander/ | 2014-06-08 09:15 | - | |
| cheetah/ | 2014-06-08 09:15 | - | |
| cheese/ | 2014-06-08 09:15 | - | |
| checkstyle/ | 2014-06-08 09:15 | - | |
| checksecurity/ | 2014-06-08 09:15 | - | |
| checkpw/ | 2014-06-08 09:15 | - | |
| checkpolicy/ | 2014-06-08 09:15 | - | |
| checkinstall/ | 2014-06-08 09:15 | - | |
| checkgmail/ | 2014-06-08 09:15 | - | |
| checkbot/ | 2014-06-08 09:15 | - | |
| check/ | 2014-06-08 09:15 | - | |
| check-postgres/ | 2014-06-08 09:15 | - | |
| check-mk/ | 2014-06-08 09:15 | - | |
| chasen/ | 2014-06-08 09:15 | - | |
| chase/ | 2014-06-08 09:15 | - | |
| charybdis/ | 2014-06-08 09:15 | - | |
| charmap.app/ | 2014-06-08 09:15 | - | |
| charls/ | 2014-06-08 09:15 | - | |
| chardet/ | 2014-06-08 09:15 | - | |
| charactermanaj/ | 2014-06-08 09:15 | - | |
| chaosreader/ | 2014-06-08 09:15 | - | |
| changetrack/ | 2014-06-08 09:15 | - | |
| chameleon-cursor-theme/ | 2014-06-08 09:15 | - | |
| chalow/ | 2014-06-08 09:15 | - | |
| chaksem/ | 2014-06-08 09:15 | - | |
| cgvg/ | 2014-06-08 09:15 | - | |
| cgsi-gsoap/ | 2014-06-08 09:15 | - | |
| cgoban/ | 2014-06-08 09:15 | - | |
| cglib/ | 2014-06-08 09:15 | - | |
| cgilib/ | 2014-06-08 09:15 | - | |
| cgiemail/ | 2014-06-08 09:15 | - | |
| cgi-extratags-perl/ | 2014-06-08 09:15 | - | |
| cgdb/ | 2014-06-08 09:15 | - | |
| cgal/ | 2014-06-08 09:15 | - | |
| cfv/ | 2014-06-08 09:15 | - | |
| cfourcc/ | 2014-06-08 09:15 | - | |
| cfortran/ | 2014-06-08 09:15 | - | |
| cflow/ | 2014-06-08 09:15 | - | |
| cfitsio3/ | 2014-06-08 09:15 | - | |
| cfingerd/ | 2014-06-08 09:15 | - | |
| cfi/ | 2014-06-08 09:15 | - | |
| cfget/ | 2014-06-08 09:15 | - | |
| cfflib/ | 2014-06-08 09:15 | - | |
| cffi/ | 2014-06-08 09:15 | - | |
| cfengine3/ | 2014-06-08 09:15 | - | |
| cfengine2/ | 2014-06-08 09:15 | - | |
| ceve/ | 2014-06-08 09:15 | - | |
| certmonger/ | 2014-06-08 09:15 | - | |
| certificatepatrol/ | 2014-06-08 09:15 | - | |
| cernlib/ | 2014-06-08 09:15 | - | |
| cerealizer/ | 2014-06-08 09:15 | - | |
| cereal/ | 2014-06-08 09:15 | - | |
| centerim/ | 2014-06-08 09:15 | - | |
| cenon.app/ | 2014-06-08 09:15 | - | |
| cellwriter/ | 2014-06-08 09:15 | - | |
| celestia/ | 2014-06-08 09:15 | - | |
| celery/ | 2014-06-08 09:15 | - | |
| cegui-mk2/ | 2014-06-08 09:15 | - | |
| ceferino/ | 2014-06-08 09:15 | - | |
| cedar-backup2/ | 2014-06-08 09:15 | - | |
| cecilia/ | 2014-06-08 09:15 | - | |
| cecil/ | 2014-06-08 09:15 | - | |
| cecil-flowanalysis/ | 2014-06-08 09:15 | - | |
| cdw/ | 2014-06-08 09:15 | - | |
| cduce/ | 2014-06-08 09:15 | - | |
| cdtool/ | 2014-06-08 09:15 | - | |
| cdrom-retriever/ | 2014-06-08 09:15 | - | |
| cdrom-detect/ | 2014-06-08 09:15 | - | |
| cdrom-checker/ | 2014-06-08 09:15 | - | |
| cdrkit/ | 2014-06-08 09:15 | - | |
| cdrdao/ | 2014-06-08 09:15 | - | |
| cdpr/ | 2014-06-08 09:15 | - | |
| cdparanoia/ | 2014-06-08 09:15 | - | |
| cdo/ | 2014-06-08 09:15 | - | |
| cdlabelgen/ | 2014-06-08 09:15 | - | |
| cdk/ | 2014-06-08 09:15 | - | |
| cdi-api/ | 2014-06-08 09:15 | - | |
| cdecl/ | 2014-06-08 09:15 | - | |
| cdebootstrap/ | 2014-06-08 09:15 | - | |
| cdebconf/ | 2014-06-08 09:15 | - | |
| cdebconf-terminal/ | 2014-06-08 09:15 | - | |
| cdebconf-entropy/ | 2014-06-08 09:15 | - | |
| cde/ | 2014-06-08 09:15 | - | |
| cddlib/ | 2014-06-08 09:15 | - | |
| cdde/ | 2014-06-08 09:15 | - | |
| cdcover/ | 2014-06-08 09:15 | - | |
| cdck/ | 2014-06-08 09:15 | - | |
| cdcd/ | 2014-06-08 09:15 | - | |
| cdcat/ | 2014-06-08 09:15 | - | |
| cdbs/ | 2014-06-08 09:15 | - | |
| cdbackup/ | 2014-06-08 09:15 | - | |
| cdargs/ | 2014-06-08 09:15 | - | |
| cd5/ | 2014-06-08 09:15 | - | |
| cd-hit/ | 2014-06-08 09:15 | - | |
| cd-discid/ | 2014-06-08 09:15 | - | |
| cd-circleprint/ | 2014-06-08 09:15 | - | |
| ccze/ | 2014-06-08 09:15 | - | |
| cctools/ | 2014-06-08 09:15 | - | |
| ccseapps/ | 2014-06-08 09:15 | - | |
| ccrypt/ | 2014-06-08 09:15 | - | |
| cconv/ | 2014-06-08 09:15 | - | |
| ccontrol/ | 2014-06-08 09:15 | - | |
| cclive/ | 2014-06-08 09:15 | - | |
| cclib/ | 2014-06-08 09:15 | - | |
| cciss-vol-status/ | 2014-06-08 09:15 | - | |
| ccid/ | 2014-06-08 09:15 | - | |
| ccfits/ | 2014-06-08 09:15 | - | |
| ccd2iso/ | 2014-06-08 09:15 | - | |
| cccd/ | 2014-06-08 09:15 | - | |
| cccc/ | 2014-06-08 09:15 | - | |
| ccbuild/ | 2014-06-08 09:15 | - | |
| ccache/ | 2014-06-08 09:15 | - | |
| cc1111/ | 2014-06-08 09:15 | - | |
| cbrpager/ | 2014-06-08 09:15 | - | |
| cbmplugs/ | 2014-06-08 09:15 | - | |
| cbmc/ | 2014-06-08 09:15 | - | |
| cbm/ | 2014-06-08 09:15 | - | |
| cbios/ | 2014-06-08 09:15 | - | |
| cbflib/ | 2014-06-08 09:15 | - | |
| cba/ | 2014-06-08 09:15 | - | |
| cb2bib/ | 2014-06-08 09:15 | - | |
| cavezofphear/ | 2014-06-08 09:15 | - | |
| catwalk/ | 2014-06-08 09:15 | - | |
| catools/ | 2014-06-08 09:15 | - | |
| catfish/ | 2014-06-08 09:15 | - | |
| catdvi/ | 2014-06-08 09:15 | - | |
| catdoc/ | 2014-06-08 09:15 | - | |
| catcodec/ | 2014-06-08 09:15 | - | |
| castor/ | 2014-06-08 09:15 | - | |
| castle-combat/ | 2014-06-08 09:15 | - | |
| caspar/ | 2014-06-08 09:15 | - | |
| carton/ | 2014-06-08 09:15 | - | |
| carmetal/ | 2014-06-08 09:15 | - | |
| caribou/ | 2014-06-08 09:15 | - | |
| carettah/ | 2014-06-08 09:15 | - | |
| caret/ | 2014-06-08 09:15 | - | |
| cardstories/ | 2014-06-08 09:15 | - | |
| car/ | 2014-06-08 09:15 | - | |
| caps/ | 2014-06-08 09:15 | - | |
| cappuccino/ | 2014-06-08 09:15 | - | |
| capistrano/ | 2014-06-08 09:15 | - | |
| capi4hylafax/ | 2014-06-08 09:15 | - | |
| cantor/ | 2014-06-08 09:15 | - | |
| canto/ | 2014-06-08 09:15 | - | |
| canna/ | 2014-06-08 09:15 | - | |
| canna-shion/ | 2014-06-08 09:15 | - | |
| canlock/ | 2014-06-08 09:15 | - | |
| camping/ | 2014-06-08 09:15 | - | |
| camorama/ | 2014-06-08 09:15 | - | |
| camomile/ | 2014-06-08 09:15 | - | |
| camlzip/ | 2014-06-08 09:15 | - | |
| camltemplate/ | 2014-06-08 09:15 | - | |
| camlp5/ | 2014-06-08 09:15 | - | |
| camlmix/ | 2014-06-08 09:15 | - | |
| camljava/ | 2014-06-08 09:15 | - | |
| camlimages/ | 2014-06-08 09:15 | - | |
| camlidl/ | 2014-06-08 09:15 | - | |
| camlidl-doc/ | 2014-06-08 09:15 | - | |
| camlbz2/ | 2014-06-08 09:15 | - | |
| caml2html/ | 2014-06-08 09:15 | - | |
| cameramonitor/ | 2014-06-08 09:15 | - | |
| camera.app/ | 2014-06-08 09:15 | - | |
| cameleon/ | 2014-06-08 09:15 | - | |
| cam/ | 2014-06-08 09:15 | - | |
| calligra/ | 2014-06-08 09:15 | - | |
| calligra-transitional/ | 2014-06-08 09:15 | - | |
| calligra-l10n/ | 2014-06-08 09:15 | - | |
| calife/ | 2014-06-08 09:15 | - | |
| calibre/ | 2014-06-08 09:15 | - | |
| calf/ | 2014-06-08 09:15 | - | |
| calendarserver/ | 2014-06-08 09:15 | - | |
| calendar/ | 2014-06-08 09:15 | - | |
| calcurse/ | 2014-06-08 09:15 | - | |
| calcoo/ | 2014-06-08 09:15 | - | |
| calamaris/ | 2014-06-08 09:15 | - | |
| calabash/ | 2014-06-08 09:15 | - | |
| cal3d/ | 2014-06-08 09:15 | - | |
| cal/ | 2014-06-08 09:15 | - | |
| cakephp/ | 2014-06-08 09:15 | - | |
| cakephp-instaweb/ | 2014-06-08 09:15 | - | |
| cairosvg/ | 2014-06-08 09:15 | - | |
| cairomm/ | 2014-06-08 09:15 | - | |
| cairodevice/ | 2014-06-08 09:15 | - | |
| cairo/ | 2014-06-08 09:15 | - | |
| cairo-ocaml/ | 2014-06-08 09:15 | - | |
| cairo-dock/ | 2014-06-08 09:15 | - | |
| cairo-dock-plug-ins/ | 2014-06-08 09:15 | - | |
| cairo-clock/ | 2014-06-08 09:15 | - | |
| cairo-5c/ | 2014-06-08 09:15 | - | |
| cain/ | 2014-06-08 09:15 | - | |
| cadubi/ | 2014-06-08 09:15 | - | |
| cadencii/ | 2014-06-08 09:15 | - | |
| cadaver/ | 2014-06-08 09:15 | - | |
| cadabra/ | 2014-06-08 09:15 | - | |
| cacti/ | 2014-06-08 09:15 | - | |
| cacti-spine/ | 2014-06-08 09:15 | - | |
| cachefilesd/ | 2014-06-08 09:15 | - | |
| cableswig/ | 2014-06-08 09:15 | - | |
| cabextract/ | 2014-06-08 09:15 | - | |
| cabal-debian/ | 2014-06-08 09:15 | - | |
| ca-certificates/ | 2014-06-08 09:15 | - | |
| ca-certificates-java/ | 2014-06-08 09:15 | - | |
| c2050/ | 2014-06-08 09:15 | - | |
| c3p0/ | 2014-06-08 09:15 | - | |
| c2hs/ | 2014-06-08 09:15 | - | |
| c2esp/ | 2014-06-08 09:15 | - | |
| c-sig/ | 2014-06-08 09:15 | - | |
| c-repl/ | 2014-06-08 09:15 | - | |
| c-icap/ | 2014-06-08 09:15 | - | |
| c-icap-modules/ | 2014-06-08 09:15 | - | |
| c-cpp-reference/ | 2014-06-08 09:15 | - | |
| c-ares/ | 2014-06-08 09:15 | - | |
| c++-annotations/ | 2014-06-08 09:15 | - | |
|
Powered by:
|
 |
 |
Your donation powers our service to the FOSS community.
|
Some content may have been moved to our new secondary mirroring service.
OSUOSL © 2024